C12H12ClNO3 — CID 57362063
4-[2-(2-chloroethoxy)ethyl]isoindole-1,3-dione (PubChem CID 57362063) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is 4-[2-(2-chloroethoxy)ethyl]isoindole-1,3-dione.
| Compound Name | 4-[2-(2-chloroethoxy)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 57362063 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 4-[2-(2-chloroethoxy)ethyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(CCOCCCl)cccc21 |
| InChI | InChI=1S/C12H12ClNO3/c13-5-7-17-6-4-8-2-1-3-9-10(8)12(16)14-11(9)15/h1-3H,4-7H2,(H,14,15,16) |
| InChIKey | OKIXDUMKPZTWCY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|