C31H30ClN5O5S — CID 139822646
[2,6-di(propan-2-yl)phenyl] 2-[5-[(4-chlorophenyl)sulfonylcarbamoylamino]-4-cyano-1-phenylpyrazol-3-yl]acetate (PubChem CID 139822646) has the molecular formula C31H30ClN5O5S and a molecular weight of 620.13 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl] 2-[5-[(4-chlorophenyl)sulfonylcarbamoylamino]-4-cyano-1-phenylpyrazol-3-yl]acetate.
| Compound Name | [2,6-di(propan-2-yl)phenyl] 2-[5-[(4-chlorophenyl)sulfonylcarbamoylamino]-4-cyano-1-phenylpyrazol-3-yl]acetate |
|---|---|
| PubChem CID | 139822646 |
| Molecular Formula | C31H30ClN5O5S |
| Molecular Weight | 620.13 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl] 2-[5-[(4-chlorophenyl)sulfonylcarbamoylamino]-4-cyano-1-phenylpyrazol-3-yl]acetate |
| SMILES | CC(C)c1cccc(C(C)C)c1OC(=O)Cc1nn(-c2ccccc2)c(NC(=O)NS(=O)(=O)c2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C31H30ClN5O5S/c1-19(2)24-11-8-12-25(20(3)4)29(24)42-28(38)17-27-26(18-33)30(37(35-27)22-9-6-5-7-10-22)34-31(39)36-43(40,41)23-15-13-21(32)14-16-23/h5-16,19-20H,17H2,1-4H3,(H2,34,36,39) |
| InChIKey | ZEIOCPHMPGEAED-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 143.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.13 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|