C35H39NO3S — CID 139823078
4-(4-tritylpiperidin-1-yl)butyl 2-methylbenzenesulfonate (PubChem CID 139823078) has the molecular formula C35H39NO3S and a molecular weight of 553.77 g/mol. Its IUPAC name is 4-(4-tritylpiperidin-1-yl)butyl 2-methylbenzenesulfonate.
| Compound Name | 4-(4-tritylpiperidin-1-yl)butyl 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139823078 |
| Molecular Formula | C35H39NO3S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 4-(4-tritylpiperidin-1-yl)butyl 2-methylbenzenesulfonate |
| SMILES | Cc1ccccc1S(=O)(=O)OCCCCN1CCC(C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C35H39NO3S/c1-29-15-11-12-22-34(29)40(37,38)39-28-14-13-25-36-26-23-33(24-27-36)35(30-16-5-2-6-17-30,31-18-7-3-8-19-31)32-20-9-4-10-21-32/h2-12,15-22,33H,13-14,23-28H2,1H3 |
| InChIKey | ZMTAOMOONZNJSR-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|