C20H31N3O7 — CID 139823651
tert-butyl N-[(2R)-1-carbamoyloxy-3-[4-[(2-methylpropan-2-yl)oxycarbamoyloxy]phenyl]propan-2-yl]carbamate (PubChem CID 139823651) has the molecular formula C20H31N3O7 and a molecular weight of 425.48 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-carbamoyloxy-3-[4-[(2-methylpropan-2-yl)oxycarbamoyloxy]phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-carbamoyloxy-3-[4-[(2-methylpropan-2-yl)oxycarbamoyloxy]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139823651 |
| Molecular Formula | C20H31N3O7 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | tert-butyl N-[(2R)-1-carbamoyloxy-3-[4-[(2-methylpropan-2-yl)oxycarbamoyloxy]phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)ONC(=O)Oc1ccc(C[C@H](COC(N)=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H31N3O7/c1-19(2,3)29-17(25)22-14(12-27-16(21)24)11-13-7-9-15(10-8-13)28-18(26)23-30-20(4,5)6/h7-10,14H,11-12H2,1-6H3,(H2,21,24)(H,22,25)(H,23,26)/t14-/m1/s1 |
| InChIKey | JQVDHIQJCXFYHW-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|