C16H14FN3O — CID 139825921
N-ethyl-3-(4-fluorophenyl)-4-pyridin-4-yl-1,2-oxazol-5-amine (PubChem CID 139825921) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is N-ethyl-3-(4-fluorophenyl)-4-pyridin-4-yl-1,2-oxazol-5-amine.
| Compound Name | N-ethyl-3-(4-fluorophenyl)-4-pyridin-4-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 139825921 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-ethyl-3-(4-fluorophenyl)-4-pyridin-4-yl-1,2-oxazol-5-amine |
| SMILES | CCNc1onc(-c2ccc(F)cc2)c1-c1ccncc1 |
| InChI | InChI=1S/C16H14FN3O/c1-2-19-16-14(11-7-9-18-10-8-11)15(20-21-16)12-3-5-13(17)6-4-12/h3-10,19H,2H2,1H3 |
| InChIKey | JZQODVURIJBGDD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |