C18H16ClN3O3 — CID 174583815
2-chloro-N-[3-(4-ethoxyphenyl)-4-pyridin-4-yl-1,2-oxazol-5-yl]acetamide (PubChem CID 174583815) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-ethoxyphenyl)-4-pyridin-4-yl-1,2-oxazol-5-yl]acetamide.
| Compound Name | 2-chloro-N-[3-(4-ethoxyphenyl)-4-pyridin-4-yl-1,2-oxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 174583815 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-chloro-N-[3-(4-ethoxyphenyl)-4-pyridin-4-yl-1,2-oxazol-5-yl]acetamide |
| SMILES | CCOc1ccc(-c2noc(NC(=O)CCl)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C18H16ClN3O3/c1-2-24-14-5-3-13(4-6-14)17-16(12-7-9-20-10-8-12)18(25-22-17)21-15(23)11-19/h3-10H,2,11H2,1H3,(H,21,23) |
| InChIKey | QRMCHSLRIASILT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|