C10H16N4O3S — CID 139826107
N-(2-methylpropoxy)-1,1-dioxo-3,4-dihydropyrido[4,3-e][1,2,4]thiadiazin-2-amine (PubChem CID 139826107) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(2-methylpropoxy)-1,1-dioxo-3,4-dihydropyrido[4,3-e][1,2,4]thiadiazin-2-amine.
| Compound Name | N-(2-methylpropoxy)-1,1-dioxo-3,4-dihydropyrido[4,3-e][1,2,4]thiadiazin-2-amine |
|---|---|
| PubChem CID | 139826107 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-(2-methylpropoxy)-1,1-dioxo-3,4-dihydropyrido[4,3-e][1,2,4]thiadiazin-2-amine |
| SMILES | CC(C)CONN1CNc2ccncc2S1(=O)=O |
| InChI | InChI=1S/C10H16N4O3S/c1-8(2)6-17-13-14-7-12-9-3-4-11-5-10(9)18(14,15)16/h3-5,8,12-13H,6-7H2,1-2H3 |
| InChIKey | MWSVDQPGOHVTBR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|