About 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide
3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide (PubChem CID 119084853) has the molecular formula C7H7N3O3S
and a molecular weight of 213.22 g/mol. Its IUPAC name is 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide.
Analyze 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide?
The IUPAC name of 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide (CID 119084853) is 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide.
What is the SMILES notation for 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide?
The canonical SMILES for 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide is COC1=NS(=O)(=O)c2cnccc2N1.
What is the InChIKey of 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide?
The InChIKey is RKSBYIPMRVLPKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3S/c1-13-7-9-5-2-3-8-4-6(5)14(11,12)10-7/h2-4H,1H3,(H,9,10).
What are the key properties of 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide?
3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide has a molecular weight of 213.22 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4H-pyrido[4,3-e][1,2,4]thiadiazine 1,1-dioxide is sourced from PubChem (CID 119084853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).