C26H21FN2O2 — CID 139827003
4-(4-fluorophenyl)-6-methoxy-9-methyl-2-(pyridin-4-ylmethyl)-1H-benzo[f]isoindol-3-one (PubChem CID 139827003) has the molecular formula C26H21FN2O2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-6-methoxy-9-methyl-2-(pyridin-4-ylmethyl)-1H-benzo[f]isoindol-3-one.
| Compound Name | 4-(4-fluorophenyl)-6-methoxy-9-methyl-2-(pyridin-4-ylmethyl)-1H-benzo[f]isoindol-3-one |
|---|---|
| PubChem CID | 139827003 |
| Molecular Formula | C26H21FN2O2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-(4-fluorophenyl)-6-methoxy-9-methyl-2-(pyridin-4-ylmethyl)-1H-benzo[f]isoindol-3-one |
| SMILES | COc1ccc2c(C)c3c(c(-c4ccc(F)cc4)c2c1)C(=O)N(Cc1ccncc1)C3 |
| InChI | InChI=1S/C26H21FN2O2/c1-16-21-8-7-20(31-2)13-22(21)24(18-3-5-19(27)6-4-18)25-23(16)15-29(26(25)30)14-17-9-11-28-12-10-17/h3-13H,14-15H2,1-2H3 |
| InChIKey | PRAFFKUCXXOASA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |