C18H13FN2O3 — CID 136654920
7-[(4-fluorophenyl)methyl]-5,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 136654920) has the molecular formula C18H13FN2O3 and a molecular weight of 324.31 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-5,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one.
| Compound Name | 7-[(4-fluorophenyl)methyl]-5,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
|---|---|
| PubChem CID | 136654920 |
| Molecular Formula | C18H13FN2O3 |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-5,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | O=C1c2c(c(O)c3cccnc3c2O)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H13FN2O3/c19-11-5-3-10(4-6-11)8-21-9-13-14(18(21)24)17(23)15-12(16(13)22)2-1-7-20-15/h1-7,22-23H,8-9H2 |
| InChIKey | FMBRQBDRJDDJMB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|