C24H18FN2O2P — CID 143149170
7-[(4-fluorophenyl)methyl]-9-hydroxy-5-(3-phosphanylphenyl)-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 143149170) has the molecular formula C24H18FN2O2P and a molecular weight of 416.39 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-9-hydroxy-5-(3-phosphanylphenyl)-6H-pyrrolo[3,4-g]quinolin-8-one.
| Compound Name | 7-[(4-fluorophenyl)methyl]-9-hydroxy-5-(3-phosphanylphenyl)-6H-pyrrolo[3,4-g]quinolin-8-one |
|---|---|
| PubChem CID | 143149170 |
| Molecular Formula | C24H18FN2O2P |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-9-hydroxy-5-(3-phosphanylphenyl)-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | O=C1c2c(c(-c3cccc(P)c3)c3cccnc3c2O)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H18FN2O2P/c25-16-8-6-14(7-9-16)12-27-13-19-20(15-3-1-4-17(30)11-15)18-5-2-10-26-22(18)23(28)21(19)24(27)29/h1-11,28H,12-13,30H2 |
| InChIKey | DGYBUDQFJZBIKS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|