C25H18F2N2O3 — CID 136613774
3,7-bis[(4-fluorophenyl)methyl]-5,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 136613774) has the molecular formula C25H18F2N2O3 and a molecular weight of 432.43 g/mol. Its IUPAC name is 3,7-bis[(4-fluorophenyl)methyl]-5,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one.
| Compound Name | 3,7-bis[(4-fluorophenyl)methyl]-5,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
|---|---|
| PubChem CID | 136613774 |
| Molecular Formula | C25H18F2N2O3 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3,7-bis[(4-fluorophenyl)methyl]-5,9-dihydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | O=C1c2c(c(O)c3cc(Cc4ccc(F)cc4)cnc3c2O)CN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H18F2N2O3/c26-17-5-1-14(2-6-17)9-16-10-19-22(28-11-16)24(31)21-20(23(19)30)13-29(25(21)32)12-15-3-7-18(27)8-4-15/h1-8,10-11,30-31H,9,12-13H2 |
| InChIKey | VKWDKZOICYGLAY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|