C22H22FN2O5P — CID 58652595
5-diethoxyphosphoryl-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 58652595) has the molecular formula C22H22FN2O5P and a molecular weight of 444.40 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one.
| Compound Name | 5-diethoxyphosphoryl-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
|---|---|
| PubChem CID | 58652595 |
| Molecular Formula | C22H22FN2O5P |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 5-diethoxyphosphoryl-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | CCOP(=O)(OCC)c1c2c(c(O)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C22H22FN2O5P/c1-3-29-31(28,30-4-2)21-16-6-5-11-24-19(16)20(26)18-17(21)13-25(22(18)27)12-14-7-9-15(23)10-8-14/h5-11,26H,3-4,12-13H2,1-2H3 |
| InChIKey | WHIRPWREKDZWMA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|