C19H13FN2O3 — CID 139827006
5-(4-fluorophenyl)-7-methoxy-4H-benzo[b][1,7]naphthyridine-1,3-dione (PubChem CID 139827006) has the molecular formula C19H13FN2O3 and a molecular weight of 336.32 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-7-methoxy-4H-benzo[b][1,7]naphthyridine-1,3-dione.
| Compound Name | 5-(4-fluorophenyl)-7-methoxy-4H-benzo[b][1,7]naphthyridine-1,3-dione |
|---|---|
| PubChem CID | 139827006 |
| Molecular Formula | C19H13FN2O3 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5-(4-fluorophenyl)-7-methoxy-4H-benzo[b][1,7]naphthyridine-1,3-dione |
| SMILES | COc1ccc2nc3c(c(-c4ccc(F)cc4)c2c1)CC(=O)NC3=O |
| InChI | InChI=1S/C19H13FN2O3/c1-25-12-6-7-15-13(8-12)17(10-2-4-11(20)5-3-10)14-9-16(23)22-19(24)18(14)21-15/h2-8H,9H2,1H3,(H,22,23,24) |
| InChIKey | ZSKOYZRBJOEAJP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|