C29H31N2O2+ — CID 134983325
3-[4-(2-methoxy-7H-indeno[2,1-c]quinolin-6-yl)phenoxy]propyl-trimethylazanium (PubChem CID 134983325) has the molecular formula C29H31N2O2+ and a molecular weight of 439.58 g/mol. Its IUPAC name is 3-[4-(2-methoxy-7H-indeno[2,1-c]quinolin-6-yl)phenoxy]propyl-trimethylazanium.
| Compound Name | 3-[4-(2-methoxy-7H-indeno[2,1-c]quinolin-6-yl)phenoxy]propyl-trimethylazanium |
|---|---|
| PubChem CID | 134983325 |
| Molecular Formula | C29H31N2O2+ |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 3-[4-(2-methoxy-7H-indeno[2,1-c]quinolin-6-yl)phenoxy]propyl-trimethylazanium |
| SMILES | COc1ccc2nc(-c3ccc(OCCC[N+](C)(C)C)cc3)c3c(c2c1)-c1ccccc1C3 |
| InChI | InChI=1S/C29H31N2O2/c1-31(2,3)16-7-17-33-22-12-10-20(11-13-22)29-26-18-21-8-5-6-9-24(21)28(26)25-19-23(32-4)14-15-27(25)30-29/h5-6,8-15,19H,7,16-18H2,1-4H3/q+1 |
| InChIKey | QIYSKAKULDAKME-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|