C13H24F3NO4Si — CID 139827854
butyl 4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate (PubChem CID 139827854) has the molecular formula C13H24F3NO4Si and a molecular weight of 343.42 g/mol. Its IUPAC name is butyl 4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate.
| Compound Name | butyl 4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 139827854 |
| Molecular Formula | C13H24F3NO4Si |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | butyl 4-methyl-5-(trifluoromethyl)-5-trimethylsilyloxy-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCOC(=O)N1COC(O[Si](C)(C)C)(C(F)(F)F)C1C |
| InChI | InChI=1S/C13H24F3NO4Si/c1-6-7-8-19-11(18)17-9-20-12(10(17)2,13(14,15)16)21-22(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | OSARCDVPIRHMDE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|