C19H21F3IN3O2 — CID 175952907
butyl (4R)-3-iodo-4-methyl-2-[4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (PubChem CID 175952907) has the molecular formula C19H21F3IN3O2 and a molecular weight of 507.29 g/mol. Its IUPAC name is butyl (4R)-3-iodo-4-methyl-2-[4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate.
| Compound Name | butyl (4R)-3-iodo-4-methyl-2-[4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 175952907 |
| Molecular Formula | C19H21F3IN3O2 |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | butyl (4R)-3-iodo-4-methyl-2-[4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| SMILES | CCCCOC(=O)N1CCn2nc(-c3ccc(C(F)(F)F)cc3)c(I)c2[C@H]1C |
| InChI | InChI=1S/C19H21F3IN3O2/c1-3-4-11-28-18(27)25-9-10-26-17(12(25)2)15(23)16(24-26)13-5-7-14(8-6-13)19(20,21)22/h5-8,12H,3-4,9-11H2,1-2H3/t12-/m1/s1 |
| InChIKey | SDIMGYOFRWTLLD-GFCCVEGCSA-N |
| XLogP | 5.49 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|