C24H22F6N4O4 — CID 53487944
dipropyl 3,6-bis[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine-1,2-dicarboxylate (PubChem CID 53487944) has the molecular formula C24H22F6N4O4 and a molecular weight of 544.45 g/mol. Its IUPAC name is dipropyl 3,6-bis[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine-1,2-dicarboxylate.
| Compound Name | dipropyl 3,6-bis[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 53487944 |
| Molecular Formula | C24H22F6N4O4 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | dipropyl 3,6-bis[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine-1,2-dicarboxylate |
| SMILES | CCCOC(=O)N1C(c2ccc(C(F)(F)F)cc2)=NN=C(c2ccc(C(F)(F)F)cc2)N1C(=O)OCCC |
| InChI | InChI=1S/C24H22F6N4O4/c1-3-13-37-21(35)33-19(15-5-9-17(10-6-15)23(25,26)27)31-32-20(34(33)22(36)38-14-4-2)16-7-11-18(12-8-16)24(28,29)30/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | QLUUBINWOQNUPQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |