C16H14N4O3S4 — CID 139830527
(6R,7R)-8-oxo-3-(thiadiazol-5-ylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid (PubChem CID 139830527) has the molecular formula C16H14N4O3S4 and a molecular weight of 438.58 g/mol. Its IUPAC name is (6R,7R)-8-oxo-3-(thiadiazol-5-ylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid.
| Compound Name | (6R,7R)-8-oxo-3-(thiadiazol-5-ylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 139830527 |
| Molecular Formula | C16H14N4O3S4 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | (6R,7R)-8-oxo-3-(thiadiazol-5-ylmethyl)-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
| SMILES | O=C(Cc1cccs1)N[C@@H]1C(=O)N2C(C(=O)S)=C(Cc3cnns3)CS[C@H]12 |
| InChI | InChI=1S/C16H14N4O3S4/c21-11(5-9-2-1-3-25-9)18-12-14(22)20-13(16(23)24)8(7-26-15(12)20)4-10-6-17-19-27-10/h1-3,6,12,15H,4-5,7H2,(H,18,21)(H,23,24)/t12-,15-/m1/s1 |
| InChIKey | CVNJKONAEGRKGG-IUODEOHRSA-N |
| XLogP | 1.50 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|