C19H30N2O5 — CID 139831127
tert-butyl N-[(2R,3S)-3-benzyl-2-carbamoyl-2,4-dimethoxybutyl]carbamate (PubChem CID 139831127) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3-benzyl-2-carbamoyl-2,4-dimethoxybutyl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3-benzyl-2-carbamoyl-2,4-dimethoxybutyl]carbamate |
|---|---|
| PubChem CID | 139831127 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3-benzyl-2-carbamoyl-2,4-dimethoxybutyl]carbamate |
| SMILES | COC[C@H](Cc1ccccc1)[C@](CNC(=O)OC(C)(C)C)(OC)C(N)=O |
| InChI | InChI=1S/C19H30N2O5/c1-18(2,3)26-17(23)21-13-19(25-5,16(20)22)15(12-24-4)11-14-9-7-6-8-10-14/h6-10,15H,11-13H2,1-5H3,(H2,20,22)(H,21,23)/t15-,19-/m0/s1 |
| InChIKey | LCHTXHUOAVPYPA-KXBFYZLASA-N |
| XLogP | 1.89 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |