C25H21ClN6O4S2 — CID 139831551
3-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-2-yl)pyrimidine-2-carbonyl]piperazin-2-yl]propanenitrile (PubChem CID 139831551) has the molecular formula C25H21ClN6O4S2 and a molecular weight of 569.07 g/mol. Its IUPAC name is 3-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-2-yl)pyrimidine-2-carbonyl]piperazin-2-yl]propanenitrile.
| Compound Name | 3-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-2-yl)pyrimidine-2-carbonyl]piperazin-2-yl]propanenitrile |
|---|---|
| PubChem CID | 139831551 |
| Molecular Formula | C25H21ClN6O4S2 |
| Molecular Weight | 569.07 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 3-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-2-yl)pyrimidine-2-carbonyl]piperazin-2-yl]propanenitrile |
| SMILES | N#CCCC1CN(S(=O)(=O)c2cc3ccc(Cl)cc3s2)CCN1C(=O)c1ncc(-c2cccc[n+]2[O-])cn1 |
| InChI | InChI=1S/C25H21ClN6O4S2/c26-19-7-6-17-12-23(37-22(17)13-19)38(35,36)30-10-11-31(20(16-30)4-3-8-27)25(33)24-28-14-18(15-29-24)21-5-1-2-9-32(21)34/h1-2,5-7,9,12-15,20H,3-4,10-11,16H2 |
| InChIKey | WHORXBSWUUUEBW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 134.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|