C27H22N6O4S2 — CID 139831634
3-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-2-yl)pyrimidine-2-carbonyl]piperazin-2-yl]propanenitrile (PubChem CID 139831634) has the molecular formula C27H22N6O4S2 and a molecular weight of 558.65 g/mol. Its IUPAC name is 3-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-2-yl)pyrimidine-2-carbonyl]piperazin-2-yl]propanenitrile.
| Compound Name | 3-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-2-yl)pyrimidine-2-carbonyl]piperazin-2-yl]propanenitrile |
|---|---|
| PubChem CID | 139831634 |
| Molecular Formula | C27H22N6O4S2 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 3-[4-[(6-ethynyl-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-2-yl)pyrimidine-2-carbonyl]piperazin-2-yl]propanenitrile |
| SMILES | C#Cc1ccc2cc(S(=O)(=O)N3CCN(C(=O)c4ncc(-c5cccc[n+]5[O-])cn4)C(CCC#N)C3)sc2c1 |
| InChI | InChI=1S/C27H22N6O4S2/c1-2-19-8-9-20-15-25(38-24(20)14-19)39(36,37)31-12-13-32(22(18-31)6-5-10-28)27(34)26-29-16-21(17-30-26)23-7-3-4-11-33(23)35/h1,3-4,7-9,11,14-17,22H,5-6,12-13,18H2 |
| InChIKey | BKPWNWAIHZDFQX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 134.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|