C27H26ClN5O5S3 — CID 139831564
2-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazole-2-carbonyl]piperazin-2-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 139831564) has the molecular formula C27H26ClN5O5S3 and a molecular weight of 632.19 g/mol. Its IUPAC name is 2-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazole-2-carbonyl]piperazin-2-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazole-2-carbonyl]piperazin-2-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 139831564 |
| Molecular Formula | C27H26ClN5O5S3 |
| Molecular Weight | 632.19 g/mol |
| Exact Mass | 631.08 |
| IUPAC Name | 2-[4-[(6-chloro-1-benzothiophen-2-yl)sulfonyl]-1-[5-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazole-2-carbonyl]piperazin-2-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | O=C(CC1CN(S(=O)(=O)c2cc3ccc(Cl)cc3s2)CCN1C(=O)c1ncc(-c2cc[n+]([O-])cc2)s1)N1CCCC1 |
| InChI | InChI=1S/C27H26ClN5O5S3/c28-20-4-3-19-13-25(39-22(19)14-20)41(37,38)32-11-12-33(21(17-32)15-24(34)30-7-1-2-8-30)27(35)26-29-16-23(40-26)18-5-9-31(36)10-6-18/h3-6,9-10,13-14,16,21H,1-2,7-8,11-12,15,17H2 |
| InChIKey | HYQMTYXIXDHXLZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 117.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|