C21H20F3N3O4 — CID 139832974
ethyl 2-[3-hydroxy-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-4-yl]acetate hydroxide (PubChem CID 139832974) has the molecular formula C21H20F3N3O4 and a molecular weight of 435.40 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-4-yl]acetate hydroxide.
| Compound Name | ethyl 2-[3-hydroxy-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-4-yl]acetate hydroxide |
|---|---|
| PubChem CID | 139832974 |
| Molecular Formula | C21H20F3N3O4 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | ethyl 2-[3-hydroxy-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-4-yl]acetate hydroxide |
| SMILES | CCOC(=O)CN1C=c2ccccc2=C2[NH2+]N(c3ccc(C(F)(F)F)cc3)C(O)=C21.[OH-] |
| InChI | InChI=1S/C21H18F3N3O3.H2O/c1-2-30-17(28)12-26-11-13-5-3-4-6-16(13)18-19(26)20(29)27(25-18)15-9-7-14(8-10-15)21(22,23)24;/h3-11,25,29H,2,12H2,1H3;1H2 |
| InChIKey | CRVSEQIRJPWAQK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|