C18H15F4N3O2 — CID 139832951
7-fluoro-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide (PubChem CID 139832951) has the molecular formula C18H15F4N3O2 and a molecular weight of 381.33 g/mol. Its IUPAC name is 7-fluoro-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide.
| Compound Name | 7-fluoro-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide |
|---|---|
| PubChem CID | 139832951 |
| Molecular Formula | C18H15F4N3O2 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 7-fluoro-4-methyl-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide |
| SMILES | CN1C=c2cc(F)ccc2=C2[NH2+]N(c3ccc(C(F)(F)F)cc3)C(O)=C21.[OH-] |
| InChI | InChI=1S/C18H13F4N3O.H2O/c1-24-9-10-8-12(19)4-7-14(10)15-16(24)17(26)25(23-15)13-5-2-11(3-6-13)18(20,21)22;/h2-9,23,26H,1H3;1H2 |
| InChIKey | LNARHFZHSCYKQV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|