C20H20F3N3O3S — CID 139832966
4-(2-methylsulfinylethyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide (PubChem CID 139832966) has the molecular formula C20H20F3N3O3S and a molecular weight of 439.46 g/mol. Its IUPAC name is 4-(2-methylsulfinylethyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide.
| Compound Name | 4-(2-methylsulfinylethyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide |
|---|---|
| PubChem CID | 139832966 |
| Molecular Formula | C20H20F3N3O3S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-(2-methylsulfinylethyl)-2-[4-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide |
| SMILES | CS(=O)CCN1C=c2ccccc2=C2[NH2+]N(c3ccc(C(F)(F)F)cc3)C(O)=C21.[OH-] |
| InChI | InChI=1S/C20H18F3N3O2S.H2O/c1-29(28)11-10-25-12-13-4-2-3-5-16(13)17-18(25)19(27)26(24-17)15-8-6-14(7-9-15)20(21,22)23;/h2-9,12,24,27H,10-11H2,1H3;1H2 |
| InChIKey | CWOUJXKTQGKELJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|