C17H15F3N4O2 — CID 140994554
4-methyl-2-[4-(trifluoromethyl)phenyl]-1,6-dihydropyrazolo[3,4-f][1,7]naphthyridin-1-ium-3-one hydroxide (PubChem CID 140994554) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,6-dihydropyrazolo[3,4-f][1,7]naphthyridin-1-ium-3-one hydroxide.
| Compound Name | 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,6-dihydropyrazolo[3,4-f][1,7]naphthyridin-1-ium-3-one hydroxide |
|---|---|
| PubChem CID | 140994554 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-methyl-2-[4-(trifluoromethyl)phenyl]-1,6-dihydropyrazolo[3,4-f][1,7]naphthyridin-1-ium-3-one hydroxide |
| SMILES | CN1C=C2NC=CC=C2C2=C1C(=O)N(c1ccc(C(F)(F)F)cc1)[NH2+]2.[OH-] |
| InChI | InChI=1S/C17H13F3N4O.H2O/c1-23-9-13-12(3-2-8-21-13)14-15(23)16(25)24(22-14)11-6-4-10(5-7-11)17(18,19)20;/h2-9,21-22H,1H3;1H2 |
| InChIKey | QGEPWSPMYARPKZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|