C11H7F8N2OP — CID 23414782
1-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3-[4-(trifluoromethyl)phenyl]-1,3,2-diazaphosphetidin-4-one (PubChem CID 23414782) has the molecular formula C11H7F8N2OP and a molecular weight of 366.15 g/mol. Its IUPAC name is 1-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3-[4-(trifluoromethyl)phenyl]-1,3,2-diazaphosphetidin-4-one.
| Compound Name | 1-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3-[4-(trifluoromethyl)phenyl]-1,3,2-diazaphosphetidin-4-one |
|---|---|
| PubChem CID | 23414782 |
| Molecular Formula | C11H7F8N2OP |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 1-methyl-2-(1,1,2,2,2-pentafluoroethyl)-3-[4-(trifluoromethyl)phenyl]-1,3,2-diazaphosphetidin-4-one |
| SMILES | Cn1c(=O)n(-c2ccc(C(F)(F)F)cc2)p1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F8N2OP/c1-20-8(22)21(23(20)11(18,19)10(15,16)17)7-4-2-6(3-5-7)9(12,13)14/h2-5H,1H3 |
| InChIKey | DXKBAYFGYQMQIN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|