C22H28O3 — CID 139833112
4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]benzene-1,3-diol (PubChem CID 139833112) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]benzene-1,3-diol.
| Compound Name | 4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 139833112 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 4-[1-(3-tert-butyl-4-hydroxyphenyl)cyclohexyl]benzene-1,3-diol |
| SMILES | CC(C)(C)c1cc(C2(c3ccc(O)cc3O)CCCCC2)ccc1O |
| InChI | InChI=1S/C22H28O3/c1-21(2,3)18-13-15(7-10-19(18)24)22(11-5-4-6-12-22)17-9-8-16(23)14-20(17)25/h7-10,13-14,23-25H,4-6,11-12H2,1-3H3 |
| InChIKey | XGMGELIORXZYJM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |