C21H33NO6 — CID 139834003
benzyl 4,4-diethoxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoate (PubChem CID 139834003) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is benzyl 4,4-diethoxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoate.
| Compound Name | benzyl 4,4-diethoxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoate |
|---|---|
| PubChem CID | 139834003 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | benzyl 4,4-diethoxy-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]butanoate |
| SMILES | CCOC(CC(CNC(=O)OC(C)(C)C)C(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C21H33NO6/c1-6-25-18(26-7-2)13-17(14-22-20(24)28-21(3,4)5)19(23)27-15-16-11-9-8-10-12-16/h8-12,17-18H,6-7,13-15H2,1-5H3,(H,22,24) |
| InChIKey | GCBPWOCXENIDPU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|