C22H27N3O3S — CID 139834035
benzyl (2S,4S)-2-[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 139834035) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is benzyl (2S,4S)-2-[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,4S)-2-[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139834035 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | benzyl (2S,4S)-2-[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CN(CCc1ccncc1)C(=O)C[C@H]1C[C@H](S)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-24(12-9-17-7-10-23-11-8-17)21(26)14-19-13-20(29)15-25(19)22(27)28-16-18-5-3-2-4-6-18/h2-8,10-11,19-20,29H,9,12-16H2,1H3/t19-,20+/m1/s1 |
| InChIKey | JGJLDWTVRZUXHT-UXHICEINSA-N |
| XLogP | 3.18 |
| TPSA | 62.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|