C27H26F4N2O2S — CID 87830621
benzyl (2S,4R)-2-[[bis[(2,5-difluorophenyl)methyl]amino]methyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 87830621) has the molecular formula C27H26F4N2O2S and a molecular weight of 518.58 g/mol. Its IUPAC name is benzyl (2S,4R)-2-[[bis[(2,5-difluorophenyl)methyl]amino]methyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,4R)-2-[[bis[(2,5-difluorophenyl)methyl]amino]methyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87830621 |
| Molecular Formula | C27H26F4N2O2S |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | benzyl (2S,4R)-2-[[bis[(2,5-difluorophenyl)methyl]amino]methyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@H](S)C[C@H]1CN(Cc1cc(F)ccc1F)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C27H26F4N2O2S/c28-21-6-8-25(30)19(10-21)13-32(14-20-11-22(29)7-9-26(20)31)15-23-12-24(36)16-33(23)27(34)35-17-18-4-2-1-3-5-18/h1-11,23-24,36H,12-17H2/t23-,24+/m0/s1 |
| InChIKey | PMZOOOKNLFNRHU-BJKOFHAPSA-N |
| XLogP | 5.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|