C30H22Br4 — CID 139834387
9,10-bis[3,5-bis(bromomethyl)phenyl]anthracene (PubChem CID 139834387) has the molecular formula C30H22Br4 and a molecular weight of 702.12 g/mol. Its IUPAC name is 9,10-bis[3,5-bis(bromomethyl)phenyl]anthracene.
| Compound Name | 9,10-bis[3,5-bis(bromomethyl)phenyl]anthracene |
|---|---|
| PubChem CID | 139834387 |
| Molecular Formula | C30H22Br4 |
| Molecular Weight | 702.12 g/mol |
| Exact Mass | 697.85 |
| IUPAC Name | 9,10-bis[3,5-bis(bromomethyl)phenyl]anthracene |
| SMILES | BrCc1cc(CBr)cc(-c2c3ccccc3c(-c3cc(CBr)cc(CBr)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C30H22Br4/c31-15-19-9-20(16-32)12-23(11-19)29-25-5-1-2-6-26(25)30(28-8-4-3-7-27(28)29)24-13-21(17-33)10-22(14-24)18-34/h1-14H,15-18H2 |
| InChIKey | OXPXBICYDKCCGR-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.12 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|