C23H23ClFN7O — CID 139834848
N-[4-(3-chloro-4-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-(4-methylpiperazin-1-yl)pent-2-ynamide (PubChem CID 139834848) has the molecular formula C23H23ClFN7O and a molecular weight of 467.94 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-(4-methylpiperazin-1-yl)pent-2-ynamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-(4-methylpiperazin-1-yl)pent-2-ynamide |
|---|---|
| PubChem CID | 139834848 |
| Molecular Formula | C23H23ClFN7O |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-(4-methylpiperazin-1-yl)pent-2-ynamide |
| SMILES | CC(C#CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cn1)N1CCN(C)CC1 |
| InChI | InChI=1S/C23H23ClFN7O/c1-15(32-9-7-31(2)8-10-32)3-6-22(33)30-21-12-17-20(13-26-21)27-14-28-23(17)29-16-4-5-19(25)18(24)11-16/h4-5,11-15H,7-10H2,1-2H3,(H,26,30,33)(H,27,28,29) |
| InChIKey | KAIHFEPQWCUQSJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|