C19H19N7S2 — CID 139834987
1-[1-[[4-[[2-(2H-tetrazol-5-yl)phenyl]methyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethane-1,1-dithiol (PubChem CID 139834987) has the molecular formula C19H19N7S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is 1-[1-[[4-[[2-(2H-tetrazol-5-yl)phenyl]methyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethane-1,1-dithiol.
| Compound Name | 1-[1-[[4-[[2-(2H-tetrazol-5-yl)phenyl]methyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethane-1,1-dithiol |
|---|---|
| PubChem CID | 139834987 |
| Molecular Formula | C19H19N7S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-[1-[[4-[[2-(2H-tetrazol-5-yl)phenyl]methyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethane-1,1-dithiol |
| SMILES | CC(S)(S)c1ncn(Cc2ccc(Cc3ccccc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C19H19N7S2/c1-19(27,28)18-20-12-26(23-18)11-14-8-6-13(7-9-14)10-15-4-2-3-5-16(15)17-21-24-25-22-17/h2-9,12,27-28H,10-11H2,1H3,(H,21,22,24,25) |
| InChIKey | FRHDLLFKWGVWQR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|