C18H21F3O4 — CID 139835041
tert-butyl 2-[cyclopropyl(hydroxy)methyl]-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate (PubChem CID 139835041) has the molecular formula C18H21F3O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is tert-butyl 2-[cyclopropyl(hydroxy)methyl]-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate.
| Compound Name | tert-butyl 2-[cyclopropyl(hydroxy)methyl]-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 139835041 |
| Molecular Formula | C18H21F3O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | tert-butyl 2-[cyclopropyl(hydroxy)methyl]-3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)C(C(=O)c1ccccc1C(F)(F)F)C(O)C1CC1 |
| InChI | InChI=1S/C18H21F3O4/c1-17(2,3)25-16(24)13(14(22)10-8-9-10)15(23)11-6-4-5-7-12(11)18(19,20)21/h4-7,10,13-14,22H,8-9H2,1-3H3 |
| InChIKey | NIIDIIPGRPLVRT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|