C20H27F3O4 — CID 140973902
tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-[2-(trifluoromethyl)benzoyl]butanoate (PubChem CID 140973902) has the molecular formula C20H27F3O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-[2-(trifluoromethyl)benzoyl]butanoate.
| Compound Name | tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-[2-(trifluoromethyl)benzoyl]butanoate |
|---|---|
| PubChem CID | 140973902 |
| Molecular Formula | C20H27F3O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | tert-butyl 3-[(2-methylpropan-2-yl)oxy]-2-[2-(trifluoromethyl)benzoyl]butanoate |
| SMILES | CC(OC(C)(C)C)C(C(=O)OC(C)(C)C)C(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H27F3O4/c1-12(26-18(2,3)4)15(17(25)27-19(5,6)7)16(24)13-10-8-9-11-14(13)20(21,22)23/h8-12,15H,1-7H3 |
| InChIKey | ZZIWXNOVROGPOY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|