C9H14ClF3N2O3 — CID 139836125
methyl (2S)-2-amino-3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoate;hydrochloride (PubChem CID 139836125) has the molecular formula C9H14ClF3N2O3 and a molecular weight of 290.67 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoate;hydrochloride.
| Compound Name | methyl (2S)-2-amino-3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 139836125 |
| Molecular Formula | C9H14ClF3N2O3 |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | methyl (2S)-2-amino-3-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]propanoate;hydrochloride |
| SMILES | C=CCN(C[C@H](N)C(=O)OC)C(=O)C(F)(F)F.Cl |
| InChI | InChI=1S/C9H13F3N2O3.ClH/c1-3-4-14(8(16)9(10,11)12)5-6(13)7(15)17-2;/h3,6H,1,4-5,13H2,2H3;1H/t6-;/m0./s1 |
| InChIKey | GNUFEVJBQYSPGO-RGMNGODLSA-N |
| XLogP | 0.49 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|