C11H17F3N2O3 — CID 79280328
methyl 3-[[2-(prop-2-enylamino)acetyl]-(2,2,2-trifluoroethyl)amino]propanoate (PubChem CID 79280328) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is methyl 3-[[2-(prop-2-enylamino)acetyl]-(2,2,2-trifluoroethyl)amino]propanoate.
| Compound Name | methyl 3-[[2-(prop-2-enylamino)acetyl]-(2,2,2-trifluoroethyl)amino]propanoate |
|---|---|
| PubChem CID | 79280328 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 3-[[2-(prop-2-enylamino)acetyl]-(2,2,2-trifluoroethyl)amino]propanoate |
| SMILES | C=CCNCC(=O)N(CCC(=O)OC)CC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3/c1-3-5-15-7-9(17)16(8-11(12,13)14)6-4-10(18)19-2/h3,15H,1,4-8H2,2H3 |
| InChIKey | VZELQRIBZYEXIZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|