C8H13F3N2O3 — CID 60646869
methyl 3-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]propanoate (PubChem CID 60646869) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is methyl 3-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]propanoate.
| Compound Name | methyl 3-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 60646869 |
| Molecular Formula | C8H13F3N2O3 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | methyl 3-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]propanoate |
| SMILES | COC(=O)CCNCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O3/c1-16-7(15)2-3-12-4-6(14)13-5-8(9,10)11/h12H,2-5H2,1H3,(H,13,14) |
| InChIKey | CZVXEUHRJWMYGF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|