C15H23NO — CID 139836558
(NE)-N-(2,6,6-trimethyl-8-methylidene-4-tricyclo[5.3.1.01,5]undecanylidene)hydroxylamine (PubChem CID 139836558) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (NE)-N-(2,6,6-trimethyl-8-methylidene-4-tricyclo[5.3.1.01,5]undecanylidene)hydroxylamine.
| Compound Name | (NE)-N-(2,6,6-trimethyl-8-methylidene-4-tricyclo[5.3.1.01,5]undecanylidene)hydroxylamine |
|---|---|
| PubChem CID | 139836558 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (NE)-N-(2,6,6-trimethyl-8-methylidene-4-tricyclo[5.3.1.01,5]undecanylidene)hydroxylamine |
| SMILES | C=C1CCC23CC1C(C)(C)C2/C(=N/O)CC3C |
| InChI | InChI=1S/C15H23NO/c1-9-5-6-15-8-11(9)14(3,4)13(15)12(16-17)7-10(15)2/h10-11,13,17H,1,5-8H2,2-4H3/b16-12+ |
| InChIKey | BLUTWRFZYLACSH-FOWTUZBSSA-N |
| XLogP | 3.86 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|