C25H24O4 — CID 139838992
4-[3-benzoyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzoic acid (PubChem CID 139838992) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is 4-[3-benzoyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzoic acid.
| Compound Name | 4-[3-benzoyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 139838992 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-[3-benzoyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]benzoic acid |
| SMILES | CCC(C)(C)c1cc(-c2ccc(C(=O)O)cc2)cc(C(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C25H24O4/c1-4-25(2,3)21-15-19(16-10-12-18(13-11-16)24(28)29)14-20(23(21)27)22(26)17-8-6-5-7-9-17/h5-15,27H,4H2,1-3H3,(H,28,29) |
| InChIKey | HXWPPHSQAOAFSQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |