4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid

C18H19ClO3 — CID 139842101

IUPAC4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid
SMILESC[C@H](C[C@@H](C)Cl)Oc1ccc(-c2ccc(C(=O)O)cc2)cc1
InChIInChI=1S/C18H19ClO3/c1-12(19)11-13(2)22-17-9-7-15(8-10-17)14-3-5-16(6-4-14)18(20)21/h3-10,12-13H,11H2,1-2H3,(H,20,21)/t12-,13-/m1/s1
InChIKeyNPMQYYZGMNGMPC-CHWSQXEVSA-N
MW318.80 g/mol
LogP4.84
Rot. Bonds6

About 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid

4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid (PubChem CID 139842101) has the molecular formula C18H19ClO3 and a molecular weight of 318.80 g/mol. Its IUPAC name is 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid.

Molecular Properties

Compound Name4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid
PubChem CID139842101
Molecular FormulaC18H19ClO3
Molecular Weight318.80 g/mol
Exact Mass318.10
IUPAC Name4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid
SMILESC[C@H](C[C@@H](C)Cl)Oc1ccc(-c2ccc(C(=O)O)cc2)cc1
InChIInChI=1S/C18H19ClO3/c1-12(19)11-13(2)22-17-9-7-15(8-10-17)14-3-5-16(6-4-14)18(20)21/h3-10,12-13H,11H2,1-2H3,(H,20,21)/t12-,13-/m1/s1
InChIKeyNPMQYYZGMNGMPC-CHWSQXEVSA-N
XLogP4.84
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.80
LogP ≤ 54.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid?
The IUPAC name of 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid (CID 139842101) is 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid.
What is the SMILES notation for 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid?
The canonical SMILES for 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid is C[C@H](C[C@@H](C)Cl)Oc1ccc(-c2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid?
The InChIKey is NPMQYYZGMNGMPC-CHWSQXEVSA-N. The full InChI is InChI=1S/C18H19ClO3/c1-12(19)11-13(2)22-17-9-7-15(8-10-17)14-3-5-16(6-4-14)18(20)21/h3-10,12-13H,11H2,1-2H3,(H,20,21)/t12-,13-/m1/s1.
What are the key properties of 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid?
4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid has a molecular weight of 318.80 g/mol, XLogP of 4.84, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2R,4R)-4-chloropentan-2-yl]oxyphenyl]benzoic acid is sourced from PubChem (CID 139842101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).