C19H22O5 — CID 70399630
4-[4-[(2R,3R)-2,3-dimethoxybutoxy]phenyl]benzoic acid (PubChem CID 70399630) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[4-[(2R,3R)-2,3-dimethoxybutoxy]phenyl]benzoic acid.
| Compound Name | 4-[4-[(2R,3R)-2,3-dimethoxybutoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 70399630 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-[4-[(2R,3R)-2,3-dimethoxybutoxy]phenyl]benzoic acid |
| SMILES | CO[C@H](C)[C@@H](COc1ccc(-c2ccc(C(=O)O)cc2)cc1)OC |
| InChI | InChI=1S/C19H22O5/c1-13(22-2)18(23-3)12-24-17-10-8-15(9-11-17)14-4-6-16(7-5-14)19(20)21/h4-11,13,18H,12H2,1-3H3,(H,20,21)/t13-,18-/m1/s1 |
| InChIKey | DXJAPQNHKJYDLP-FZKQIMNGSA-N |
| XLogP | 3.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |