C13H14F3NO4 — CID 23511923
4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid (PubChem CID 23511923) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid.
| Compound Name | 4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 23511923 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[2-[methyl-(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid |
| SMILES | CC(COc1ccc(C(=O)O)cc1)N(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO4/c1-8(17(2)12(20)13(14,15)16)7-21-10-5-3-9(4-6-10)11(18)19/h3-6,8H,7H2,1-2H3,(H,18,19) |
| InChIKey | SFANBYNQUGVWQT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |