C30H38FN3O3 — CID 139842529
[(2S,3S,5R)-5-(butylcarbamoyl)-8-fluoro-3-methyl-1-phenylnonan-2-yl] quinoxaline-2-carboxylate (PubChem CID 139842529) has the molecular formula C30H38FN3O3 and a molecular weight of 507.65 g/mol. Its IUPAC name is [(2S,3S,5R)-5-(butylcarbamoyl)-8-fluoro-3-methyl-1-phenylnonan-2-yl] quinoxaline-2-carboxylate.
| Compound Name | [(2S,3S,5R)-5-(butylcarbamoyl)-8-fluoro-3-methyl-1-phenylnonan-2-yl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 139842529 |
| Molecular Formula | C30H38FN3O3 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | [(2S,3S,5R)-5-(butylcarbamoyl)-8-fluoro-3-methyl-1-phenylnonan-2-yl] quinoxaline-2-carboxylate |
| SMILES | CCCCNC(=O)[C@H](CCC(C)F)C[C@H](C)[C@H](Cc1ccccc1)OC(=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C30H38FN3O3/c1-4-5-17-32-29(35)24(16-15-22(3)31)18-21(2)28(19-23-11-7-6-8-12-23)37-30(36)27-20-33-25-13-9-10-14-26(25)34-27/h6-14,20-22,24,28H,4-5,15-19H2,1-3H3,(H,32,35)/t21-,22?,24+,28-/m0/s1 |
| InChIKey | PVCWWWNDRHBEDX-AYYQVUAPSA-N |
| XLogP | 6.09 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|