C21H24O4S — CID 139843613
7-(4-phenacyloxyphenyl)-2-sulfanylheptanoic acid (PubChem CID 139843613) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is 7-(4-phenacyloxyphenyl)-2-sulfanylheptanoic acid.
| Compound Name | 7-(4-phenacyloxyphenyl)-2-sulfanylheptanoic acid |
|---|---|
| PubChem CID | 139843613 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 7-(4-phenacyloxyphenyl)-2-sulfanylheptanoic acid |
| SMILES | O=C(COc1ccc(CCCCCC(S)C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O4S/c22-19(17-8-4-2-5-9-17)15-25-18-13-11-16(12-14-18)7-3-1-6-10-20(26)21(23)24/h2,4-5,8-9,11-14,20,26H,1,3,6-7,10,15H2,(H,23,24) |
| InChIKey | BSXRGQNEILSADH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|