C21H26O3S — CID 139843677
7-[4-(1-phenoxyethyl)phenyl]-2-sulfanylheptanoic acid (PubChem CID 139843677) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is 7-[4-(1-phenoxyethyl)phenyl]-2-sulfanylheptanoic acid.
| Compound Name | 7-[4-(1-phenoxyethyl)phenyl]-2-sulfanylheptanoic acid |
|---|---|
| PubChem CID | 139843677 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 7-[4-(1-phenoxyethyl)phenyl]-2-sulfanylheptanoic acid |
| SMILES | CC(Oc1ccccc1)c1ccc(CCCCCC(S)C(=O)O)cc1 |
| InChI | InChI=1S/C21H26O3S/c1-16(24-19-9-5-3-6-10-19)18-14-12-17(13-15-18)8-4-2-7-11-20(25)21(22)23/h3,5-6,9-10,12-16,20,25H,2,4,7-8,11H2,1H3,(H,22,23) |
| InChIKey | XJIDSYUSUZZSAY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|