C28H33NO5 — CID 139845589
(2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[2-(4-methoxyphenyl)ethoxy]phenyl]methylidene]-4-oxobutanoic acid (PubChem CID 139845589) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[2-(4-methoxyphenyl)ethoxy]phenyl]methylidene]-4-oxobutanoic acid.
| Compound Name | (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[2-(4-methoxyphenyl)ethoxy]phenyl]methylidene]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139845589 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[2-(4-methoxyphenyl)ethoxy]phenyl]methylidene]-4-oxobutanoic acid |
| SMILES | COc1ccc(CCOc2ccc(/C=C(\CC(=O)N3C[C@H]4CCCC[C@H]4C3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H33NO5/c1-33-25-10-6-20(7-11-25)14-15-34-26-12-8-21(9-13-26)16-24(28(31)32)17-27(30)29-18-22-4-2-3-5-23(22)19-29/h6-13,16,22-23H,2-5,14-15,17-19H2,1H3,(H,31,32)/b24-16+/t22-,23+ |
| InChIKey | SSZICPFRLUIGBU-UZFYWESVSA-N |
| XLogP | 4.82 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|