C29H34N2O5 — CID 139845651
(2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[2-[benzoyl(methyl)amino]ethoxy]phenyl]methylidene]-4-oxobutanoic acid (PubChem CID 139845651) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[2-[benzoyl(methyl)amino]ethoxy]phenyl]methylidene]-4-oxobutanoic acid.
| Compound Name | (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[2-[benzoyl(methyl)amino]ethoxy]phenyl]methylidene]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139845651 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (2E)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[[4-[2-[benzoyl(methyl)amino]ethoxy]phenyl]methylidene]-4-oxobutanoic acid |
| SMILES | CN(CCOc1ccc(/C=C(\CC(=O)N2C[C@H]3CCCC[C@H]3C2)C(=O)O)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34N2O5/c1-30(28(33)22-7-3-2-4-8-22)15-16-36-26-13-11-21(12-14-26)17-25(29(34)35)18-27(32)31-19-23-9-5-6-10-24(23)20-31/h2-4,7-8,11-14,17,23-24H,5-6,9-10,15-16,18-20H2,1H3,(H,34,35)/b25-17+/t23-,24+ |
| InChIKey | UMDFZAHVVSXXCY-WECRISLISA-N |
| XLogP | 4.34 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|